ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5197-28-4 2-Bromo-4-nitroanisole |
|
Nazwa produktu: | 2-Bromo-4-nitroanisole |
Angielska nazwa | 2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-;2-bromo-1-methoxy-4-nitrobenzene |
MF | C7H6BrNO3 |
Masie cząsteczkowej | 232.0314 |
InChI | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
Nr CAS | 5197-28-4 |
EINECS | 225-983-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.64g/cm3 |
Temperatura topnienia | 104-106℃ |
Temperatura wrzenia | 306.3°C at 760 mmHg |
Współczynnik załamania | 1.581 |
Temperatura zapłonu | 139.1°C |
Ciśnienie pary | 0.00141mmHg at 25°C |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |