ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5197-28-4 2-Bromo-4-nitroanisole |
|
Nama produk | 2-Bromo-4-nitroanisole |
Nama bahasa Inggris | 2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-;2-bromo-1-methoxy-4-nitrobenzene |
MF | C7H6BrNO3 |
Berat Molekul | 232.0314 |
InChI | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
CAS NO | 5197-28-4 |
EINECS | 225-983-5 |
Struktur Molekul | ![]() |
Kepadatan | 1.64g/cm3 |
Titik lebur | 104-106℃ |
Titik didih | 306.3°C at 760 mmHg |
Indeks bias | 1.581 |
Titik nyala | 139.1°C |
Tekanan uap | 0.00141mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |