ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5197-28-4 2-Bromo-4-nitroanisole |
|
उत्पाद का नाम | 2-Bromo-4-nitroanisole |
अंग्रेज | 2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-;2-bromo-1-methoxy-4-nitrobenzene |
आणविक फार्मूला | C7H6BrNO3 |
आण्विक वजन | 232.0314 |
InChI | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
कैस रजिस्टी संख्या | 5197-28-4 |
EINECS | 225-983-5 |
आणविक संरचना | ![]() |
घनत्व | 1.64g/cm3 |
गलनांक | 104-106℃ |
उबलने का समय | 306.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.581 |
फ्लैश प्वाइंट | 139.1°C |
वाष्प का दबाव | 0.00141mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |