ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5197-28-4 2-Bromo-4-nitroanisole |
|
Ürün Adı | 2-Bromo-4-nitroanisole |
ingilizce adı | 2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-;2-bromo-1-methoxy-4-nitrobenzene |
Moleküler Formülü | C7H6BrNO3 |
Molekül Ağırlığı | 232.0314 |
InChI | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
CAS kayıt numarası | 5197-28-4 |
EINECS | 225-983-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.64g/cm3 |
Ergime noktası | 104-106℃ |
Kaynama noktası | 306.3°C at 760 mmHg |
Kırılma indisi | 1.581 |
Alevlenme noktası | 139.1°C |
Buhar basıncı | 0.00141mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |