ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-71-3 Ethyl 3,5-dinitrobenzoate | |
| Produkt-Name | Ethyl 3,5-dinitrobenzoate | 
| Englischer Name | Ethyl 3,5-dinitrobenzoate;3,5-Dinitrobenzoic acid ethyl ester | 
| Molekulare Formel | C9H8N2O6 | 
| Molecular Weight | 240.1696 | 
| InChl | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 | 
| CAS Registry Number | 618-71-3 | 
| EINECS | 210-559-4 | 
| Molecular Structure |  | 
| Dichte | 1.433g/cm3 | 
| Schmelzpunkt | 94-95℃ | 
| Siedepunkt | 367.1°C at 760 mmHg | 
| Brechungsindex | 1.58 | 
| Flammpunkt | 171.8°C | 
| Dampfdruck | 1.39E-05mmHg at 25°C | 
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |