ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-71-3 Ethyl 3,5-dinitrobenzoate | |
| Nome del prodotto | Ethyl 3,5-dinitrobenzoate | 
| Nome inglese | Ethyl 3,5-dinitrobenzoate;3,5-Dinitrobenzoic acid ethyl ester | 
| Formula molecolare | C9H8N2O6 | 
| Peso Molecolare | 240.1696 | 
| InChI | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 | 
| Numero CAS | 618-71-3 | 
| EINECS | 210-559-4 | 
| Struttura molecolare |  | 
| Densità | 1.433g/cm3 | 
| Punto di fusione | 94-95℃ | 
| Punto di ebollizione | 367.1°C at 760 mmHg | 
| Indice di rifrazione | 1.58 | 
| Punto d'infiammabilità | 171.8°C | 
| Pressione di vapore | 1.39E-05mmHg at 25°C | 
| Sicurezza Descrizione | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |