ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-71-3 Ethyl 3,5-dinitrobenzoate | |
| Naam product | Ethyl 3,5-dinitrobenzoate | 
| Engelse naam | Ethyl 3,5-dinitrobenzoate;3,5-Dinitrobenzoic acid ethyl ester | 
| MF | C9H8N2O6 | 
| Molecuulgewicht | 240.1696 | 
| InChI | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 | 
| CAS-nummer | 618-71-3 | 
| EINECS | 210-559-4 | 
| Moleculaire Structuur |  | 
| Dichtheid | 1.433g/cm3 | 
| Smeltpunt | 94-95℃ | 
| Kookpunt | 367.1°C at 760 mmHg | 
| Brekingsindex | 1.58 | 
| Vlampunt | 171.8°C | 
| Dampdruk | 1.39E-05mmHg at 25°C | 
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |