ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 618-71-3 Ethyl 3,5-dinitrobenzoate | |
| Nome do produto | Ethyl 3,5-dinitrobenzoate | 
| Nome em inglês | Ethyl 3,5-dinitrobenzoate;3,5-Dinitrobenzoic acid ethyl ester | 
| Fórmula molecular | C9H8N2O6 | 
| Peso Molecular | 240.1696 | 
| InChI | InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 | 
| CAS Registry Number | 618-71-3 | 
| EINECS | 210-559-4 | 
| Estrutura Molecular |  | 
| Densidade | 1.433g/cm3 | 
| Ponto de fusão | 94-95℃ | 
| Ponto de ebulição | 367.1°C at 760 mmHg | 
| índice de refração | 1.58 | 
| O ponto de inflamação | 171.8°C | 
| Pressão de vapor | 1.39E-05mmHg at 25°C | 
| Descrição da Segurança | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |