Chemindex > 68512-53-8
DE ▼
68512-53-8 Borsäure (H3BO3), Reaktionsprodukte mit Ethanolamin und Triethanolamin |
|
| Produkt-Name | Borsäure (H3BO3), Reaktionsprodukte mit Ethanolamin und Triethanolamin |
| Synonyme | Triethanolamin-, Ethanolamin-, Borsäure-Reaktionsprodukte; 2-Aminoethanol; 2-(Bis(2-hydroxyethyl)amino)ethanol; Borsäure; |
| Englischer Name | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine;Triethanolamine, ethanolamine, boric acid reaction products;2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
| Molekulare Formel | C8H25BN2O7 |
| Molecular Weight | 272.1043 |
| InChl | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
| CAS Registry Number | 68512-53-8 |
| EINECS | 270-982-5 |
| Molecular Structure |  |
| Siedepunkt | 335.4°C at 760 mmHg |
| Flammpunkt | 185°C |
| Dampfdruck | 8.38E-06mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 68512-53-8 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 