ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68512-53-8 Boorzuur (H3BO3), reactieproducten met ethanolamine en triethanolamine |
|
Naam product | Boorzuur (H3BO3), reactieproducten met ethanolamine en triethanolamine |
Synoniemen | Triethanolamine, ethanolamine, boorzuurreactieproducten; 2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; Boorzuur; |
Engelse naam | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine;Triethanolamine, ethanolamine, boric acid reaction products;2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
MF | C8H25BN2O7 |
Molecuulgewicht | 272.1043 |
InChI | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
CAS-nummer | 68512-53-8 |
EINECS | 270-982-5 |
Moleculaire Structuur | ![]() |
Kookpunt | 335.4°C at 760 mmHg |
Vlampunt | 185°C |
Dampdruk | 8.38E-06mmHg at 25°C |
MSDS |