ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68512-53-8 붕산 (H3BO3), 에탄올 아민 및 트리에탄올 아민과의 반응 생성물 |
|
상품명칭 | 붕산 (H3BO3), 에탄올 아민 및 트리에탄올 아민과의 반응 생성물 |
별명 | 트리에탄올아민, 에탄올아민, 붕산 반응 생성물; 2-아미노에탄올; 2-(비스(2-하이드록시에틸)아미노)에탄올; 붕산; |
영문 이름 | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine;Triethanolamine, ethanolamine, boric acid reaction products;2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
분자식 | C8H25BN2O7 |
분자량 | 272.1043 |
InChI | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
cas번호 | 68512-53-8 |
EC번호 | 270-982-5 |
분자 구조 | ![]() |
비등점 | 335.4°C at 760 mmHg |
인화점 | 185°C |
증기압 | 8.38E-06mmHg at 25°C |
MSDS |