ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68512-53-8 Borik asit (H3BO3), etanolamin ve trietanolamin ile reaksiyon ürünleri |
|
Ürün Adı | Borik asit (H3BO3), etanolamin ve trietanolamin ile reaksiyon ürünleri |
Eş anlamlı | Trietanolamin, etanolamin, borik asit reaksiyon ürünleri; 2-aminoetanol; 2- (bis (2-hidroksietil) amino) etanol; borik asit; |
ingilizce adı | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine;Triethanolamine, ethanolamine, boric acid reaction products;2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
Moleküler Formülü | C8H25BN2O7 |
Molekül Ağırlığı | 272.1043 |
InChI | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
CAS kayıt numarası | 68512-53-8 |
EINECS | 270-982-5 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 335.4°C at 760 mmHg |
Alevlenme noktası | 185°C |
Buhar basıncı | 8.38E-06mmHg at 25°C |
MSDS |