Chemindex > 68512-53-8
NO ▼
68512-53-8 Borsyre (H3BO3), reaksjonsprodukter med etanolamin og trietanolamin |
|
| produktnavn | Borsyre (H3BO3), reaksjonsprodukter med etanolamin og trietanolamin |
| Synonymer | Trietanolamin, etanolamin, borsyrereaksjonsprodukter; 2-aminoetanol; 2-(bis(2-hydroksyetyl)amino)etanol; borsyre; |
| Engelsk navn | Boric acid (H3BO3), reaction products with ethanolamine and triethanolamine;Triethanolamine, ethanolamine, boric acid reaction products;2-aminoethanol; 2-(bis(2-hydroxyethyl)amino)ethanol; boric acid |
| Molekylær Formel | C8H25BN2O7 |
| Molekylvekt | 272.1043 |
| InChI | InChI=1/C6H15NO3.C2H7NO.BH3O3/c8-4-1-7(2-5-9)3-6-10;3-1-2-4;2-1(3)4/h8-10H,1-6H2;4H,1-3H2;2-4H |
| CAS-nummer | 68512-53-8 |
| EINECS | 270-982-5 |
| Molecular Structure |  |
| Kokepunkt | 335.4°C at 760 mmHg |
| Flammepunktet | 185°C |
| Damptrykk | 8.38E-06mmHg at 25°C |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 68512-53-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 