ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-25-3 2,4,5-trifluorobenzyl alcohol |
|
Ονομασία του προϊόντος | 2,4,5-trifluorobenzyl alcohol |
Αγγλικό όνομα | 2,4,5-trifluorobenzyl alcohol;(2,4,5-trifluorophenyl)methanol |
MF | C7H5F3O |
Μοριακό βάρος | 162.11 |
InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
CAS ΟΧΙ | 144284-25-3 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.858g/cm3 |
Σημείο βρασμού | 213.308°C at 760 mmHg |
Δείκτης διάθλασης | 1.55 |
Σημείο ανάφλεξης | 82.806°C |
Πίεση ατμών | 0.113mmHg at 25°C |
Κινδύνου Κώδικες | R36/38##Irritating to eyes and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |