ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-25-3 2,4,5-trifluorobenzyl alcohol |
|
Nome del prodotto | 2,4,5-trifluorobenzyl alcohol |
Nome inglese | 2,4,5-trifluorobenzyl alcohol;(2,4,5-trifluorophenyl)methanol |
Formula molecolare | C7H5F3O |
Peso Molecolare | 162.11 |
InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
Numero CAS | 144284-25-3 |
Struttura molecolare | ![]() |
Densità | 1.858g/cm3 |
Punto di ebollizione | 213.308°C at 760 mmHg |
Indice di rifrazione | 1.55 |
Punto d'infiammabilità | 82.806°C |
Pressione di vapore | 0.113mmHg at 25°C |
Codici di Rischio | R36/38##Irritating to eyes and skin.:; |
Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |