ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-25-3 2,4,5-trifluorobenzyl alcohol |
|
اسم المنتج | 2,4,5-trifluorobenzyl alcohol |
الاسم بالانجليزية | 2,4,5-trifluorobenzyl alcohol;(2,4,5-trifluorophenyl)methanol |
الصيغة الجزيئية | C7H5F3O |
الوزن الجزيئي الغرامي | 162.11 |
InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
إستراتيجية المساعدة القطرية | 144284-25-3 |
بنية جزيئية | ![]() |
كثافة | 1.858g/cm3 |
نقطة الغليان | 213.308°C at 760 mmHg |
معامل الإنكسار | 1.55 |
نقطة الوميض | 82.806°C |
ضغط البخار | 0.113mmHg at 25°C |
خطر المصطلحات | R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |