ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-25-3 2,4,5-trifluorobenzyl alcohol |
|
उत्पाद का नाम | 2,4,5-trifluorobenzyl alcohol |
अंग्रेज | 2,4,5-trifluorobenzyl alcohol;(2,4,5-trifluorophenyl)methanol |
आणविक फार्मूला | C7H5F3O |
आण्विक वजन | 162.11 |
InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
कैस रजिस्टी संख्या | 144284-25-3 |
आणविक संरचना | ![]() |
घनत्व | 1.858g/cm3 |
उबलने का समय | 213.308°C at 760 mmHg |
अपवर्तक सूचकांक | 1.55 |
फ्लैश प्वाइंट | 82.806°C |
वाष्प का दबाव | 0.113mmHg at 25°C |
खतरे के कोड | R36/38##Irritating to eyes and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |