ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
144284-25-3 2,4,5-trifluorobenzyl alcohol |
|
Ürün Adı | 2,4,5-trifluorobenzyl alcohol |
ingilizce adı | 2,4,5-trifluorobenzyl alcohol;(2,4,5-trifluorophenyl)methanol |
Moleküler Formülü | C7H5F3O |
Molekül Ağırlığı | 162.11 |
InChI | InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
CAS kayıt numarası | 144284-25-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.858g/cm3 |
Kaynama noktası | 213.308°C at 760 mmHg |
Kırılma indisi | 1.55 |
Alevlenme noktası | 82.806°C |
Buhar basıncı | 0.113mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |