ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9010-77-9 Ethylene/acrylic acid copolymer |
|
| Ονομασία του προϊόντος | Ethylene/acrylic acid copolymer |
| Αγγλικό όνομα | Ethylene/acrylic acid copolymer;Poly(ethylene-co-acrylic acid);Ethylene-acrylic acid resin (90/10;prop-2-enoic acid - ethene (1:1);Ethylene acrylic acid copolymer;EAA |
| MF | C5H8O2 |
| Μοριακό βάρος | 100.1158 |
| InChI | InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS ΟΧΙ | 9010-77-9 |
| Μοριακή δομή | ![]() |
| Σημείο τήξης | 87-101℃ |
| Σημείο βρασμού | 141°C at 760 mmHg |
| Σημείο ανάφλεξης | 61.6°C |
| Πίεση ατμών | 3.42mmHg at 25°C |
| Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |