ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9010-77-9 Ethylene/acrylic acid copolymer |
|
| produktnavn | Ethylene/acrylic acid copolymer |
| Engelsk navn | Ethylene/acrylic acid copolymer;Poly(ethylene-co-acrylic acid);Ethylene-acrylic acid resin (90/10;prop-2-enoic acid - ethene (1:1);Ethylene acrylic acid copolymer;EAA |
| Molekylær Formel | C5H8O2 |
| Molekylvekt | 100.1158 |
| InChI | InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS-nummer | 9010-77-9 |
| Molecular Structure | ![]() |
| Smeltepunkt | 87-101℃ |
| Kokepunkt | 141°C at 760 mmHg |
| Flammepunktet | 61.6°C |
| Damptrykk | 3.42mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |