ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9010-77-9 Ethylene/acrylic acid copolymer |
|
| 상품명칭 | Ethylene/acrylic acid copolymer |
| 영문 이름 | Ethylene/acrylic acid copolymer;Poly(ethylene-co-acrylic acid);Ethylene-acrylic acid resin (90/10;prop-2-enoic acid - ethene (1:1);Ethylene acrylic acid copolymer;EAA |
| 분자식 | C5H8O2 |
| 분자량 | 100.1158 |
| InChI | InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| cas번호 | 9010-77-9 |
| 분자 구조 | ![]() |
| 녹는 점 | 87-101℃ |
| 비등점 | 141°C at 760 mmHg |
| 인화점 | 61.6°C |
| 증기압 | 3.42mmHg at 25°C |
| 보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |