ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9010-77-9 Ethylene/acrylic acid copolymer |
|
| Nome do produto | Ethylene/acrylic acid copolymer |
| Nome em inglês | Ethylene/acrylic acid copolymer;Poly(ethylene-co-acrylic acid);Ethylene-acrylic acid resin (90/10;prop-2-enoic acid - ethene (1:1);Ethylene acrylic acid copolymer;EAA |
| Fórmula molecular | C5H8O2 |
| Peso Molecular | 100.1158 |
| InChI | InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS Registry Number | 9010-77-9 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 87-101℃ |
| Ponto de ebulição | 141°C at 760 mmHg |
| O ponto de inflamação | 61.6°C |
| Pressão de vapor | 3.42mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |