ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
9010-77-9 Ethylene/acrylic acid copolymer |
|
| Ürün Adı | Ethylene/acrylic acid copolymer |
| ingilizce adı | Ethylene/acrylic acid copolymer;Poly(ethylene-co-acrylic acid);Ethylene-acrylic acid resin (90/10;prop-2-enoic acid - ethene (1:1);Ethylene acrylic acid copolymer;EAA |
| Moleküler Formülü | C5H8O2 |
| Molekül Ağırlığı | 100.1158 |
| InChI | InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS kayıt numarası | 9010-77-9 |
| Moleküler Yapısı | ![]() |
| Ergime noktası | 87-101℃ |
| Kaynama noktası | 141°C at 760 mmHg |
| Alevlenme noktası | 61.6°C |
| Buhar basıncı | 3.42mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |