ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
937-63-3 p-Tolyl chlorothionoformate |
|
Ονομασία του προϊόντος | p-Tolyl chlorothionoformate |
Αγγλικό όνομα | p-Tolyl chlorothionoformate;p-Tolyl chlorothioformate;O-(4-methylphenyl) carbonochloridothioate |
MF | C8H7ClOS |
Μοριακό βάρος | 186.6586 |
InChI | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
CAS ΟΧΙ | 937-63-3 |
EINECS | 213-333-3 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.277g/cm3 |
Σημείο βρασμού | 244.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.598 |
Σημείο ανάφλεξης | 101.8°C |
Πίεση ατμών | 0.0466mmHg at 25°C |
Κινδύνου Κώδικες | R34##Causes burns.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |