Chemindex >937-63-3
MY ▼
937-63-3 p-Tolyl chlorothionoformate |
|
| Nama produk | p-Tolyl chlorothionoformate |
| Nama Inggeris | p-Tolyl chlorothionoformate;p-Tolyl chlorothioformate;O-(4-methylphenyl) carbonochloridothioate |
| MF | C8H7ClOS |
| Berat Molekul | 186.6586 |
| InChI | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| CAS NO | 937-63-3 |
| EINECS | 213-333-3 |
| Struktur Molekul |  |
| Kepadatan | 1.277g/cm3 |
| Titik didih | 244.8°C at 760 mmHg |
| Indeks bias | 1.598 |
| Titik nyala | 101.8°C |
| Tekanan wap | 0.0466mmHg at 25°C |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 