ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
937-63-3 p-Tolyl chlorothionoformate |
|
שם המוצר | p-Tolyl chlorothionoformate |
שם אנגלי | p-Tolyl chlorothionoformate;p-Tolyl chlorothioformate;O-(4-methylphenyl) carbonochloridothioate |
מולקולרית פורמולה | C8H7ClOS |
משקל מולקולרי | 186.6586 |
InChl | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
מספר CAS | 937-63-3 |
EINECS | 213-333-3 |
מבנה מולקולרי | ![]() |
צפיפות | 1.277g/cm3 |
נקודת רתיחה | 244.8°C at 760 mmHg |
משקל סגולי | 1.598 |
נקודת הבזק | 101.8°C |
לחץ אדים | 0.0466mmHg at 25°C |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |