Chemindex > 937-63-3
HU ▼
937-63-3 p-Tolyl chlorothionoformate |
|
| termék neve | p-Tolyl chlorothionoformate |
| Angol név | p-Tolyl chlorothionoformate;p-Tolyl chlorothioformate;O-(4-methylphenyl) carbonochloridothioate |
| MF | C8H7ClOS |
| Molekulatömeg | 186.6586 |
| InChI | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| CAS-szám | 937-63-3 |
| EINECS | 213-333-3 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.277g/cm3 |
| Forráspont | 244.8°C at 760 mmHg |
| Törésmutató | 1.598 |
| Gyulladáspont | 101.8°C |
| Gőznyomás | 0.0466mmHg at 25°C |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 