Chemindex > 937-63-3
NO ▼
937-63-3 p-Tolyl chlorothionoformate |
|
| produktnavn | p-Tolyl chlorothionoformate |
| Engelsk navn | p-Tolyl chlorothionoformate;p-Tolyl chlorothioformate;O-(4-methylphenyl) carbonochloridothioate |
| Molekylær Formel | C8H7ClOS |
| Molekylvekt | 186.6586 |
| InChI | InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
| CAS-nummer | 937-63-3 |
| EINECS | 213-333-3 |
| Molecular Structure |  |
| Tetthet | 1.277g/cm3 |
| Kokepunkt | 244.8°C at 760 mmHg |
| Brytningsindeks | 1.598 |
| Flammepunktet | 101.8°C |
| Damptrykk | 0.0466mmHg at 25°C |
| Risiko Koder | R34##Causes burns.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 