Chemindex > 207974-14-9
HU ▼
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
|
| termék neve | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
| Angol név | 4-Bromo-2,5-difluorobenzenesulphonyl chloride;4-bromo-2,5-difluorobenzenesulfonyl chloride;3,4-dihydro-2H-chromen-2-ylmethanol;1,3-difluoro-2-isothiocyanatobenzene |
| MF | C7H3F2NS |
| Molekulatömeg | 171.1672 |
| InChI | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| CAS-szám | 207974-14-9 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.26g/cm3 |
| Olvadáspont | 37℃ |
| Forráspont | 221.6°C at 760 mmHg |
| Törésmutató | 1.536 |
| Gyulladáspont | 87.8°C |
| Gőznyomás | 0.158mmHg at 25°C |
| Veszély szimbólumok |  C##Corrosive:; |
| Kockázatot kódok | R34##Causes burns.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 