Chemindex > 207974-14-9
SA ▼
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
|
| اسم المنتج | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
| الاسم بالانجليزية | 4-Bromo-2,5-difluorobenzenesulphonyl chloride;4-bromo-2,5-difluorobenzenesulfonyl chloride;3,4-dihydro-2H-chromen-2-ylmethanol;1,3-difluoro-2-isothiocyanatobenzene |
| الصيغة الجزيئية | C7H3F2NS |
| الوزن الجزيئي الغرامي | 171.1672 |
| InChI | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| إستراتيجية المساعدة القطرية | 207974-14-9 |
| بنية جزيئية |  |
| كثافة | 1.26g/cm3 |
| درجة الإنصهار | 37℃ |
| نقطة الغليان | 221.6°C at 760 mmHg |
| معامل الإنكسار | 1.536 |
| نقطة الوميض | 87.8°C |
| ضغط البخار | 0.158mmHg at 25°C |
| علامات على البضائع الخطرة |  C##Corrosive:; |
| خطر المصطلحات | R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 