ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
|
उत्पाद का नाम | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
अंग्रेज | 4-Bromo-2,5-difluorobenzenesulphonyl chloride;4-bromo-2,5-difluorobenzenesulfonyl chloride;3,4-dihydro-2H-chromen-2-ylmethanol;1,3-difluoro-2-isothiocyanatobenzene |
आणविक फार्मूला | C7H3F2NS |
आण्विक वजन | 171.1672 |
InChI | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
कैस रजिस्टी संख्या | 207974-14-9 |
आणविक संरचना | ![]() |
घनत्व | 1.26g/cm3 |
गलनांक | 37℃ |
उबलने का समय | 221.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.536 |
फ्लैश प्वाइंट | 87.8°C |
वाष्प का दबाव | 0.158mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |