ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
|
نام محصول | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
نام انگلیسی | 4-Bromo-2,5-difluorobenzenesulphonyl chloride;4-bromo-2,5-difluorobenzenesulfonyl chloride;3,4-dihydro-2H-chromen-2-ylmethanol;1,3-difluoro-2-isothiocyanatobenzene |
میدان مغناطیسی | C7H3F2NS |
وزن مولکولی | 171.1672 |
InChI | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
شماره سیایاس | 207974-14-9 |
ساختار مولکولی | ![]() |
تراکم | 1.26g/cm3 |
نقطه ذوب | 37℃ |
نقطه غلیان | 221.6°C at 760 mmHg |
ضریب شکست | 1.536 |
نقطه اشتعال | 87.8°C |
فشار بخار | 0.158mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |