Chemindex > 207974-14-9
IL ▼
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
|
| שם המוצר | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
| שם אנגלי | 4-Bromo-2,5-difluorobenzenesulphonyl chloride;4-bromo-2,5-difluorobenzenesulfonyl chloride;3,4-dihydro-2H-chromen-2-ylmethanol;1,3-difluoro-2-isothiocyanatobenzene |
| מולקולרית פורמולה | C7H3F2NS |
| משקל מולקולרי | 171.1672 |
| InChl | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| מספר CAS | 207974-14-9 |
| מבנה מולקולרי |  |
| צפיפות | 1.26g/cm3 |
| נקודת ההתוך | 37℃ |
| נקודת רתיחה | 221.6°C at 760 mmHg |
| משקל סגולי | 1.536 |
| נקודת הבזק | 87.8°C |
| לחץ אדים | 0.158mmHg at 25°C |
| Hazard סימנים |  C##Corrosive:; |
| סיכונים קודי | R34##Causes burns.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 