Chemindex > 206761-91-3
ID ▼
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate |
|
| Nama produk | 2,4,6-(trifluorophenyl)isothiocyanate |
| Nama bahasa Inggris | 2,4,6-(trifluorophenyl)isothiocyanate;2,4,6-Trifluorophenyl isothiocyanate;1,3,5-trifluoro-2-isothiocyanatobenzene |
| MF | C7H2F3NS |
| Berat Molekul | 189.1577 |
| InChI | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| CAS NO | 206761-91-3 |
| Struktur Molekul |  |
| Kepadatan | 1.36g/cm3 |
| Titik didih | 213.9°C at 760 mmHg |
| Indeks bias | 1.52 |
| Titik nyala | 83.1°C |
| Tekanan uap | 0.234mmHg at 25°C |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 