Chemindex > 206761-91-3
SA ▼
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate |
|
| اسم المنتج | 2,4,6-(trifluorophenyl)isothiocyanate |
| الاسم بالانجليزية | 2,4,6-(trifluorophenyl)isothiocyanate;2,4,6-Trifluorophenyl isothiocyanate;1,3,5-trifluoro-2-isothiocyanatobenzene |
| الصيغة الجزيئية | C7H2F3NS |
| الوزن الجزيئي الغرامي | 189.1577 |
| InChI | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| إستراتيجية المساعدة القطرية | 206761-91-3 |
| بنية جزيئية |  |
| كثافة | 1.36g/cm3 |
| نقطة الغليان | 213.9°C at 760 mmHg |
| معامل الإنكسار | 1.52 |
| نقطة الوميض | 83.1°C |
| ضغط البخار | 0.234mmHg at 25°C |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 