ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate |
|
| उत्पाद का नाम | 2,4,6-(trifluorophenyl)isothiocyanate |
| अंग्रेज | 2,4,6-(trifluorophenyl)isothiocyanate;2,4,6-Trifluorophenyl isothiocyanate;1,3,5-trifluoro-2-isothiocyanatobenzene |
| आणविक फार्मूला | C7H2F3NS |
| आण्विक वजन | 189.1577 |
| InChI | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| कैस रजिस्टी संख्या | 206761-91-3 |
| आणविक संरचना | ![]() |
| घनत्व | 1.36g/cm3 |
| उबलने का समय | 213.9°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.52 |
| फ्लैश प्वाइंट | 83.1°C |
| वाष्प का दबाव | 0.234mmHg at 25°C |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |