ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate |
|
| Nama produk | 2,4,6-(trifluorophenyl)isothiocyanate |
| Nama Inggeris | 2,4,6-(trifluorophenyl)isothiocyanate;2,4,6-Trifluorophenyl isothiocyanate;1,3,5-trifluoro-2-isothiocyanatobenzene |
| MF | C7H2F3NS |
| Berat Molekul | 189.1577 |
| InChI | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| CAS NO | 206761-91-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.36g/cm3 |
| Titik didih | 213.9°C at 760 mmHg |
| Indeks bias | 1.52 |
| Titik nyala | 83.1°C |
| Tekanan wap | 0.234mmHg at 25°C |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |