Chemindex > 206761-91-3
IL ▼
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate |
|
| שם המוצר | 2,4,6-(trifluorophenyl)isothiocyanate |
| שם אנגלי | 2,4,6-(trifluorophenyl)isothiocyanate;2,4,6-Trifluorophenyl isothiocyanate;1,3,5-trifluoro-2-isothiocyanatobenzene |
| מולקולרית פורמולה | C7H2F3NS |
| משקל מולקולרי | 189.1577 |
| InChl | InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| מספר CAS | 206761-91-3 |
| מבנה מולקולרי |  |
| צפיפות | 1.36g/cm3 |
| נקודת רתיחה | 213.9°C at 760 mmHg |
| משקל סגולי | 1.52 |
| נקודת הבזק | 83.1°C |
| לחץ אדים | 0.234mmHg at 25°C |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
שירות מסד הנתונים של CAS כימי מסופק ע& 