ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56540-70-6 1-benzofuran-5-karbonil klorida |
|
Nama produk | 1-benzofuran-5-karbonil klorida |
Nama bahasa Inggris | 1-benzofuran-5-carbonyl chloride; |
MF | C9H5ClO2 |
Berat Molekul | 180.5878 |
InChI | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
CAS NO | 56540-70-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.36g/cm3 |
Titik lebur | 67℃ |
Titik didih | 260.8°C at 760 mmHg |
Indeks bias | 1.62 |
Titik nyala | 111.6°C |
Tekanan uap | 0.0119mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |