ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56540-70-6 1-benzofuran-5-karbonylklorid |
|
produktnavn | 1-benzofuran-5-karbonylklorid |
Engelsk navn | 1-benzofuran-5-carbonyl chloride; |
Molekylær Formel | C9H5ClO2 |
Molekylvekt | 180.5878 |
InChI | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
CAS-nummer | 56540-70-6 |
Molecular Structure | ![]() |
Tetthet | 1.36g/cm3 |
Smeltepunkt | 67℃ |
Kokepunkt | 260.8°C at 760 mmHg |
Brytningsindeks | 1.62 |
Flammepunktet | 111.6°C |
Damptrykk | 0.0119mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |