ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56540-70-6 1-بنزوفيوران-5-كلوريد الكربونيل ؛ |
|
اسم المنتج | 1-بنزوفيوران-5-كلوريد الكربونيل ؛ |
الاسم بالانجليزية | 1-benzofuran-5-carbonyl chloride; |
الصيغة الجزيئية | C9H5ClO2 |
الوزن الجزيئي الغرامي | 180.5878 |
InChI | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
إستراتيجية المساعدة القطرية | 56540-70-6 |
بنية جزيئية | ![]() |
كثافة | 1.36g/cm3 |
درجة الإنصهار | 67℃ |
نقطة الغليان | 260.8°C at 760 mmHg |
معامل الإنكسار | 1.62 |
نقطة الوميض | 111.6°C |
ضغط البخار | 0.0119mmHg at 25°C |
علامات على البضائع الخطرة | |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |