ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56540-70-6 chlorek 1-benzofuran-5-karbonylu |
|
Nazwa produktu: | chlorek 1-benzofuran-5-karbonylu |
Angielska nazwa | 1-benzofuran-5-carbonyl chloride; |
MF | C9H5ClO2 |
Masie cząsteczkowej | 180.5878 |
InChI | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
Nr CAS | 56540-70-6 |
Struktury molekularnej | ![]() |
Gęstość | 1.36g/cm3 |
Temperatura topnienia | 67℃ |
Temperatura wrzenia | 260.8°C at 760 mmHg |
Współczynnik załamania | 1.62 |
Temperatura zapłonu | 111.6°C |
Ciśnienie pary | 0.0119mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |