ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56540-70-6 1-benzofuran-5-karbonil klorür |
|
Ürün Adı | 1-benzofuran-5-karbonil klorür |
Eş anlamlı | |
ingilizce adı | 1-benzofuran-5-carbonyl chloride; |
Moleküler Formülü | C9H5ClO2 |
Molekül Ağırlığı | 180.5878 |
InChI | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
CAS kayıt numarası | 56540-70-6 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.36g/cm3 |
Ergime noktası | 67℃ |
Kaynama noktası | 260.8°C at 760 mmHg |
Kırılma indisi | 1.62 |
Alevlenme noktası | 111.6°C |
Buhar basıncı | 0.0119mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |