ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
155632-41-0 3,4-Dimethylthiophene-2,5-dicarbonitrile |
|
| שם המוצר | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| שם אנגלי | 3,4-Dimethylthiophene-2,5-dicarbonitrile;2,5-Dicyano-3,4-dimethylthiophene |
| מולקולרית פורמולה | C8H6N2S |
| משקל מולקולרי | 162.2116 |
| InChl | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| מספר CAS | 155632-41-0 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.22g/cm3 |
| נקודת ההתוך | 122-124℃ |
| נקודת רתיחה | 305.5°C at 760 mmHg |
| משקל סגולי | 1.568 |
| נקודת הבזק | 138.6°C |
| לחץ אדים | 0.000818mmHg at 25°C |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |