ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
155632-41-0 3,4-Dimethylthiophene-2,5-dicarbonitrile |
|
| उत्पाद का नाम | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| अंग्रेज | 3,4-Dimethylthiophene-2,5-dicarbonitrile;2,5-Dicyano-3,4-dimethylthiophene |
| आणविक फार्मूला | C8H6N2S |
| आण्विक वजन | 162.2116 |
| InChI | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| कैस रजिस्टी संख्या | 155632-41-0 |
| आणविक संरचना | ![]() |
| घनत्व | 1.22g/cm3 |
| गलनांक | 122-124℃ |
| उबलने का समय | 305.5°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.568 |
| फ्लैश प्वाइंट | 138.6°C |
| वाष्प का दबाव | 0.000818mmHg at 25°C |
| खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |