ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
155632-41-0 3,4-Dimethylthiophene-2,5-dicarbonitrile |
|
| Nama produk | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| Nama Inggeris | 3,4-Dimethylthiophene-2,5-dicarbonitrile;2,5-Dicyano-3,4-dimethylthiophene |
| MF | C8H6N2S |
| Berat Molekul | 162.2116 |
| InChI | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| CAS NO | 155632-41-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.22g/cm3 |
| Titik lebur | 122-124℃ |
| Titik didih | 305.5°C at 760 mmHg |
| Indeks bias | 1.568 |
| Titik nyala | 138.6°C |
| Tekanan wap | 0.000818mmHg at 25°C |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |