ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
155632-41-0 3,4-Dimethylthiophene-2,5-dicarbonitrile |
|
| اسم المنتج | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| الاسم بالانجليزية | 3,4-Dimethylthiophene-2,5-dicarbonitrile;2,5-Dicyano-3,4-dimethylthiophene |
| الصيغة الجزيئية | C8H6N2S |
| الوزن الجزيئي الغرامي | 162.2116 |
| InChI | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| إستراتيجية المساعدة القطرية | 155632-41-0 |
| بنية جزيئية | ![]() |
| كثافة | 1.22g/cm3 |
| درجة الإنصهار | 122-124℃ |
| نقطة الغليان | 305.5°C at 760 mmHg |
| معامل الإنكسار | 1.568 |
| نقطة الوميض | 138.6°C |
| ضغط البخار | 0.000818mmHg at 25°C |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |