ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
155632-41-0 3,4-Dimethylthiophene-2,5-dicarbonitrile |
|
| Ürün Adı | 3,4-Dimethylthiophene-2,5-dicarbonitrile |
| ingilizce adı | 3,4-Dimethylthiophene-2,5-dicarbonitrile;2,5-Dicyano-3,4-dimethylthiophene |
| Moleküler Formülü | C8H6N2S |
| Molekül Ağırlığı | 162.2116 |
| InChI | InChI=1/C8H6N2S/c1-5-6(2)8(4-10)11-7(5)3-9/h1-2H3 |
| CAS kayıt numarası | 155632-41-0 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.22g/cm3 |
| Ergime noktası | 122-124℃ |
| Kaynama noktası | 305.5°C at 760 mmHg |
| Kırılma indisi | 1.568 |
| Alevlenme noktası | 138.6°C |
| Buhar basıncı | 0.000818mmHg at 25°C |
| Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |