ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-98-8 मिथाइल 3- (क्लोरोसल्फोनील) -4-फिनाइल-5- (ट्राइफ्लोरोमेथाइल) थियोफीन-2-कार्बोक्सिलेट |
|
उत्पाद का नाम | मिथाइल 3- (क्लोरोसल्फोनील) -4-फिनाइल-5- (ट्राइफ्लोरोमेथाइल) थियोफीन-2-कार्बोक्सिलेट |
समानार्थी | 1- {2 - [(2-क्लोरो-6-फ्लोरोबेंज़िल) सल्फ़नील] एथिल} -2-मिथाइल-5-फिनाइल-1 एच-पायरोल-3-कार्बोक्जिलिक एसिड; |
अंग्रेज | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate;1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
आणविक फार्मूला | C21H19ClFNO2S |
आण्विक वजन | 403.8975 |
InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
कैस रजिस्टी संख्या | 306935-98-8 |
आणविक संरचना | ![]() |
घनत्व | 1.27g/cm3 |
गलनांक | 68℃ |
उबलने का समय | 566.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.608 |
फ्लैश प्वाइंट | 296.5°C |
वाष्प का दबाव | 1.13E-13mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |