ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-98-8 메틸 3- (클로로 술 포닐) -4- 페닐 -5- (트리 플루오로 메틸) 티오펜 -2- 카르 복실 레이트 |
|
상품명칭 | 메틸 3- (클로로 술 포닐) -4- 페닐 -5- (트리 플루오로 메틸) 티오펜 -2- 카르 복실 레이트 |
별명 | 1-{2-[(2-클로로-6-플루오로벤질)설파닐]에틸}-2-메틸-5-페닐-1H-피롤-3-카르복실산; |
영문 이름 | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate;1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
분자식 | C21H19ClFNO2S |
분자량 | 403.8975 |
InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
cas번호 | 306935-98-8 |
분자 구조 | ![]() |
밀도 | 1.27g/cm3 |
녹는 점 | 68℃ |
비등점 | 566.6°C at 760 mmHg |
굴절 지수 | 1.608 |
인화점 | 296.5°C |
증기압 | 1.13E-13mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |